C23H27N5O2 — CID 123553559
tert-butyl N-[(3S)-1-(6-pyrimidin-2-ylquinolin-4-yl)piperidin-3-yl]carbamate (PubChem CID 123553559) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-(6-pyrimidin-2-ylquinolin-4-yl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-(6-pyrimidin-2-ylquinolin-4-yl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 123553559 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | tert-butyl N-[(3S)-1-(6-pyrimidin-2-ylquinolin-4-yl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCN(c2ccnc3ccc(-c4ncccn4)cc23)C1 |
| InChI | InChI=1S/C23H27N5O2/c1-23(2,3)30-22(29)27-17-6-4-13-28(15-17)20-9-12-24-19-8-7-16(14-18(19)20)21-25-10-5-11-26-21/h5,7-12,14,17H,4,6,13,15H2,1-3H3,(H,27,29)/t17-/m0/s1 |
| InChIKey | UEQPOMMBSXNBCQ-KRWDZBQOSA-N |
| XLogP | 4.19 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |