C28H37ClN4O4 — CID 172626280
tert-butyl N-[(3S)-1-[2-chloro-5-[4-[(4-hydroxycyclohexyl)carbamoyl]phenyl]-4-pyridinyl]piperidin-3-yl]carbamate (PubChem CID 172626280) has the molecular formula C28H37ClN4O4 and a molecular weight of 529.08 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[2-chloro-5-[4-[(4-hydroxycyclohexyl)carbamoyl]phenyl]-4-pyridinyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[2-chloro-5-[4-[(4-hydroxycyclohexyl)carbamoyl]phenyl]-4-pyridinyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 172626280 |
| Molecular Formula | C28H37ClN4O4 |
| Molecular Weight | 529.08 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | tert-butyl N-[(3S)-1-[2-chloro-5-[4-[(4-hydroxycyclohexyl)carbamoyl]phenyl]-4-pyridinyl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCN(c2cc(Cl)ncc2-c2ccc(C(=O)NC3CCC(O)CC3)cc2)C1 |
| InChI | InChI=1S/C28H37ClN4O4/c1-28(2,3)37-27(36)32-21-5-4-14-33(17-21)24-15-25(29)30-16-23(24)18-6-8-19(9-7-18)26(35)31-20-10-12-22(34)13-11-20/h6-9,15-16,20-22,34H,4-5,10-14,17H2,1-3H3,(H,31,35)(H,32,36)/t20?,21-,22?/m0/s1 |
| InChIKey | HXSXGWCWTAPYEG-ORFBVSJDSA-N |
| XLogP | 4.93 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.08 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|