C16H25ClN4O4 — CID 130442292
tert-butyl N-[(3S)-1-[2-chloro-5-[hydroxy(methoxy)amino]-4-pyridinyl]piperidin-3-yl]carbamate (PubChem CID 130442292) has the molecular formula C16H25ClN4O4 and a molecular weight of 372.85 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[2-chloro-5-[hydroxy(methoxy)amino]-4-pyridinyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[2-chloro-5-[hydroxy(methoxy)amino]-4-pyridinyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 130442292 |
| Molecular Formula | C16H25ClN4O4 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | tert-butyl N-[(3S)-1-[2-chloro-5-[hydroxy(methoxy)amino]-4-pyridinyl]piperidin-3-yl]carbamate |
| SMILES | CON(O)c1cnc(Cl)cc1N1CCC[C@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H25ClN4O4/c1-16(2,3)25-15(22)19-11-6-5-7-20(10-11)12-8-14(17)18-9-13(12)21(23)24-4/h8-9,11,23H,5-7,10H2,1-4H3,(H,19,22)/t11-/m0/s1 |
| InChIKey | ABYSJFACUIDSAL-NSHDSACASA-N |
| XLogP | 2.99 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|