C23H29ClN4O3 — CID 172626587
tert-butyl N-[(3S)-1-[5-(4-acetamidophenyl)-2-chloro-4-pyridinyl]piperidin-3-yl]carbamate (PubChem CID 172626587) has the molecular formula C23H29ClN4O3 and a molecular weight of 444.96 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[5-(4-acetamidophenyl)-2-chloro-4-pyridinyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[5-(4-acetamidophenyl)-2-chloro-4-pyridinyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 172626587 |
| Molecular Formula | C23H29ClN4O3 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | tert-butyl N-[(3S)-1-[5-(4-acetamidophenyl)-2-chloro-4-pyridinyl]piperidin-3-yl]carbamate |
| SMILES | CC(=O)Nc1ccc(-c2cnc(Cl)cc2N2CCC[C@H](NC(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C23H29ClN4O3/c1-15(29)26-17-9-7-16(8-10-17)19-13-25-21(24)12-20(19)28-11-5-6-18(14-28)27-22(30)31-23(2,3)4/h7-10,12-13,18H,5-6,11,14H2,1-4H3,(H,26,29)(H,27,30)/t18-/m0/s1 |
| InChIKey | UPHKMTVRFPGHIY-SFHVURJKSA-N |
| XLogP | 4.85 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|