C24H34ClN5O3 — CID 172626864
tert-butyl N-[(3S)-1-[2-chloro-5-[6-[2-(dimethylamino)ethoxy]-3-pyridinyl]-4-pyridinyl]piperidin-3-yl]carbamate (PubChem CID 172626864) has the molecular formula C24H34ClN5O3 and a molecular weight of 476.02 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[2-chloro-5-[6-[2-(dimethylamino)ethoxy]-3-pyridinyl]-4-pyridinyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[2-chloro-5-[6-[2-(dimethylamino)ethoxy]-3-pyridinyl]-4-pyridinyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 172626864 |
| Molecular Formula | C24H34ClN5O3 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | tert-butyl N-[(3S)-1-[2-chloro-5-[6-[2-(dimethylamino)ethoxy]-3-pyridinyl]-4-pyridinyl]piperidin-3-yl]carbamate |
| SMILES | CN(C)CCOc1ccc(-c2cnc(Cl)cc2N2CCC[C@H](NC(=O)OC(C)(C)C)C2)cn1 |
| InChI | InChI=1S/C24H34ClN5O3/c1-24(2,3)33-23(31)28-18-7-6-10-30(16-18)20-13-21(25)26-15-19(20)17-8-9-22(27-14-17)32-12-11-29(4)5/h8-9,13-15,18H,6-7,10-12,16H2,1-5H3,(H,28,31)/t18-/m0/s1 |
| InChIKey | YSWJOVOGKRFYPA-SFHVURJKSA-N |
| XLogP | 4.23 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|