C21H25ClN6O2 — CID 86707103
tert-butyl N-[(3S)-1-[6-(6-chloropyrazolo[4,3-c]pyridin-1-yl)-2-pyridinyl]piperidin-3-yl]carbamate (PubChem CID 86707103) has the molecular formula C21H25ClN6O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[6-(6-chloropyrazolo[4,3-c]pyridin-1-yl)-2-pyridinyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[6-(6-chloropyrazolo[4,3-c]pyridin-1-yl)-2-pyridinyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 86707103 |
| Molecular Formula | C21H25ClN6O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | tert-butyl N-[(3S)-1-[6-(6-chloropyrazolo[4,3-c]pyridin-1-yl)-2-pyridinyl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCN(c2cccc(-n3ncc4cnc(Cl)cc43)n2)C1 |
| InChI | InChI=1S/C21H25ClN6O2/c1-21(2,3)30-20(29)25-15-6-5-9-27(13-15)18-7-4-8-19(26-18)28-16-10-17(22)23-11-14(16)12-24-28/h4,7-8,10-12,15H,5-6,9,13H2,1-3H3,(H,25,29)/t15-/m0/s1 |
| InChIKey | OCKXMSLOFGJAKB-HNNXBMFYSA-N |
| XLogP | 3.96 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|