C27H39BrFN5O4Si — CID 86669212
tert-butyl N-[(3S,5R)-1-[3-[(6-bromo-5-fluoropyridine-2-carbonyl)amino]-4-pyridinyl]-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-yl]carbamate (PubChem CID 86669212) has the molecular formula C27H39BrFN5O4Si and a molecular weight of 624.63 g/mol. Its IUPAC name is tert-butyl N-[(3S,5R)-1-[3-[(6-bromo-5-fluoropyridine-2-carbonyl)amino]-4-pyridinyl]-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,5R)-1-[3-[(6-bromo-5-fluoropyridine-2-carbonyl)amino]-4-pyridinyl]-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 86669212 |
| Molecular Formula | C27H39BrFN5O4Si |
| Molecular Weight | 624.63 g/mol |
| Exact Mass | 623.19 |
| IUPAC Name | tert-butyl N-[(3S,5R)-1-[3-[(6-bromo-5-fluoropyridine-2-carbonyl)amino]-4-pyridinyl]-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN(c2ccncc2NC(=O)c2ccc(F)c(Br)n2)C1 |
| InChI | InChI=1S/C27H39BrFN5O4Si/c1-26(2,3)37-25(36)31-17-13-18(38-39(7,8)27(4,5)6)16-34(15-17)22-11-12-30-14-21(22)33-24(35)20-10-9-19(29)23(28)32-20/h9-12,14,17-18H,13,15-16H2,1-8H3,(H,31,36)(H,33,35)/t17-,18+/m0/s1 |
| InChIKey | RPRYJNGVLWZMDL-ZWKOTPCHSA-N |
| XLogP | 6.12 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.63 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|