C23H34Cl2FN5O3Si — CID 174032785
tert-butyl N-[(3S)-5-[tert-butyl(dimethyl)silyl]oxy-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)piperidin-3-yl]carbamate (PubChem CID 174032785) has the molecular formula C23H34Cl2FN5O3Si and a molecular weight of 546.55 g/mol. Its IUPAC name is tert-butyl N-[(3S)-5-[tert-butyl(dimethyl)silyl]oxy-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-5-[tert-butyl(dimethyl)silyl]oxy-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 174032785 |
| Molecular Formula | C23H34Cl2FN5O3Si |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | tert-butyl N-[(3S)-5-[tert-butyl(dimethyl)silyl]oxy-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC(O[Si](C)(C)C(C)(C)C)CN(c2nc(Cl)nc3c(F)c(Cl)ncc23)C1 |
| InChI | InChI=1S/C23H34Cl2FN5O3Si/c1-22(2,3)33-21(32)28-13-9-14(34-35(7,8)23(4,5)6)12-31(11-13)19-15-10-27-18(24)16(26)17(15)29-20(25)30-19/h10,13-14H,9,11-12H2,1-8H3,(H,28,32)/t13-,14?/m0/s1 |
| InChIKey | OBJVXEIUQZDFJD-LSLKUGRBSA-N |
| XLogP | 5.96 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|