C21H29Cl2FN4OSi — CID 177330037
tert-butyl-[[6-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-6-azaspiro[3.5]nonan-2-yl]oxy]-dimethylsilane (PubChem CID 177330037) has the molecular formula C21H29Cl2FN4OSi and a molecular weight of 471.48 g/mol. Its IUPAC name is tert-butyl-[[6-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-6-azaspiro[3.5]nonan-2-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[6-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-6-azaspiro[3.5]nonan-2-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 177330037 |
| Molecular Formula | C21H29Cl2FN4OSi |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | tert-butyl-[[6-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-6-azaspiro[3.5]nonan-2-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC2(CCCN(c3nc(Cl)nc4c(F)c(Cl)ncc34)C2)C1 |
| InChI | InChI=1S/C21H29Cl2FN4OSi/c1-20(2,3)30(4,5)29-13-9-21(10-13)7-6-8-28(12-21)18-14-11-25-17(22)15(24)16(14)26-19(23)27-18/h11,13H,6-10,12H2,1-5H3 |
| InChIKey | VRBYPTGKSWFWHH-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|