C17H20Cl2FN5 — CID 175943159
4-[(1R,5S)-1-tert-butyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidine (PubChem CID 175943159) has the molecular formula C17H20Cl2FN5 and a molecular weight of 384.29 g/mol. Its IUPAC name is 4-[(1R,5S)-1-tert-butyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidine.
| Compound Name | 4-[(1R,5S)-1-tert-butyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 175943159 |
| Molecular Formula | C17H20Cl2FN5 |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 4-[(1R,5S)-1-tert-butyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidine |
| SMILES | CC(C)(C)[C@]12CC[C@@H](CN(c3nc(Cl)nc4c(F)c(Cl)ncc34)C1)N2 |
| InChI | InChI=1S/C17H20Cl2FN5/c1-16(2,3)17-5-4-9(24-17)7-25(8-17)14-10-6-21-13(18)11(20)12(10)22-15(19)23-14/h6,9,24H,4-5,7-8H2,1-3H3/t9-,17-/m0/s1 |
| InChIKey | LYYLXDYZCBNRPA-XYZCENFISA-N |
| XLogP | 3.83 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|