C25H34ClFN6O — CID 175889260
4-[(1R,5S)-1-tert-butyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine (PubChem CID 175889260) has the molecular formula C25H34ClFN6O and a molecular weight of 489.04 g/mol. Its IUPAC name is 4-[(1R,5S)-1-tert-butyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine.
| Compound Name | 4-[(1R,5S)-1-tert-butyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 175889260 |
| Molecular Formula | C25H34ClFN6O |
| Molecular Weight | 489.04 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 4-[(1R,5S)-1-tert-butyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
| SMILES | CC(C)(C)[C@]12CC[C@@H](CN(c3nc(OCC45CCCN4CCC5)nc4c(F)c(Cl)ncc34)C1)N2 |
| InChI | InChI=1S/C25H34ClFN6O/c1-23(2,3)25-9-6-16(31-25)13-32(14-25)21-17-12-28-20(26)18(27)19(17)29-22(30-21)34-15-24-7-4-10-33(24)11-5-8-24/h12,16,31H,4-11,13-15H2,1-3H3/t16-,25-/m0/s1 |
| InChIKey | BNANYJNFQCKHKD-LMKMVOKYSA-N |
| XLogP | 4.18 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.04 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|