C24H30ClF2N5O2 — CID 175977793
7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[1-(methoxymethyl)-3-azabicyclo[3.2.1]octan-3-yl]pyrido[4,3-d]pyrimidine (PubChem CID 175977793) has the molecular formula C24H30ClF2N5O2 and a molecular weight of 493.99 g/mol. Its IUPAC name is 7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[1-(methoxymethyl)-3-azabicyclo[3.2.1]octan-3-yl]pyrido[4,3-d]pyrimidine.
| Compound Name | 7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[1-(methoxymethyl)-3-azabicyclo[3.2.1]octan-3-yl]pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 175977793 |
| Molecular Formula | C24H30ClF2N5O2 |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[1-(methoxymethyl)-3-azabicyclo[3.2.1]octan-3-yl]pyrido[4,3-d]pyrimidine |
| SMILES | COCC12CCC(CN(c3nc(OC[C@@]45CCCN4C[C@H](F)C5)nc4c(F)c(Cl)ncc34)C1)C2 |
| InChI | InChI=1S/C24H30ClF2N5O2/c1-33-13-23-5-3-15(7-23)10-31(12-23)21-17-9-28-20(25)18(27)19(17)29-22(30-21)34-14-24-4-2-6-32(24)11-16(26)8-24/h9,15-16H,2-8,10-14H2,1H3/t15?,16-,23?,24+/m1/s1 |
| InChIKey | IXABOEPMVARBCJ-DSLGRUEFSA-N |
| XLogP | 4.03 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|