C24H29F3N4O — CID 175636826
6,8-difluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[(1S,5S)-1-methyl-3-azabicyclo[3.2.1]octan-3-yl]quinazoline (PubChem CID 175636826) has the molecular formula C24H29F3N4O and a molecular weight of 446.52 g/mol. Its IUPAC name is 6,8-difluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[(1S,5S)-1-methyl-3-azabicyclo[3.2.1]octan-3-yl]quinazoline.
| Compound Name | 6,8-difluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[(1S,5S)-1-methyl-3-azabicyclo[3.2.1]octan-3-yl]quinazoline |
|---|---|
| PubChem CID | 175636826 |
| Molecular Formula | C24H29F3N4O |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 6,8-difluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[(1S,5S)-1-methyl-3-azabicyclo[3.2.1]octan-3-yl]quinazoline |
| SMILES | C[C@@]12CC[C@H](CN(c3nc(OCC45CCCN4C[C@H](F)C5)nc4c(F)cc(F)cc34)C1)C2 |
| InChI | InChI=1S/C24H29F3N4O/c1-23-5-3-15(9-23)11-30(13-23)21-18-7-16(25)8-19(27)20(18)28-22(29-21)32-14-24-4-2-6-31(24)12-17(26)10-24/h7-8,15,17H,2-6,9-14H2,1H3/t15-,17+,23-,24?/m0/s1 |
| InChIKey | YOAWBEKDFZPBEU-ZUGYAXATSA-N |
| XLogP | 4.49 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |