C22H27BrF3N5O — CID 171613477
(3R)-1-[7-bromo-6,8-difluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-3-methylpiperidin-3-amine (PubChem CID 171613477) has the molecular formula C22H27BrF3N5O and a molecular weight of 514.39 g/mol. Its IUPAC name is (3R)-1-[7-bromo-6,8-difluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-3-methylpiperidin-3-amine.
| Compound Name | (3R)-1-[7-bromo-6,8-difluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-3-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 171613477 |
| Molecular Formula | C22H27BrF3N5O |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | (3R)-1-[7-bromo-6,8-difluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-3-methylpiperidin-3-amine |
| SMILES | C[C@@]1(N)CCCN(c2nc(OC[C@@]34CCCN3C[C@H](F)C4)nc3c(F)c(Br)c(F)cc23)C1 |
| InChI | InChI=1S/C22H27BrF3N5O/c1-21(27)4-2-6-30(11-21)19-14-8-15(25)16(23)17(26)18(14)28-20(29-19)32-12-22-5-3-7-31(22)10-13(24)9-22/h8,13H,2-7,9-12,27H2,1H3/t13-,21-,22+/m1/s1 |
| InChIKey | KIHQIRJHHHPUKC-DZKUTHLPSA-N |
| XLogP | 3.94 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|