C17H17BrF2IN3OS — CID 177213366
7-bromo-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6-iodo-4-methylsulfanylquinazoline (PubChem CID 177213366) has the molecular formula C17H17BrF2IN3OS and a molecular weight of 556.21 g/mol. Its IUPAC name is 7-bromo-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6-iodo-4-methylsulfanylquinazoline.
| Compound Name | 7-bromo-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6-iodo-4-methylsulfanylquinazoline |
|---|---|
| PubChem CID | 177213366 |
| Molecular Formula | C17H17BrF2IN3OS |
| Molecular Weight | 556.21 g/mol |
| Exact Mass | 554.93 |
| IUPAC Name | 7-bromo-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6-iodo-4-methylsulfanylquinazoline |
| SMILES | CSc1nc(OC[C@@]23CCCN2C[C@H](F)C3)nc2c(F)c(Br)c(I)cc12 |
| InChI | InChI=1S/C17H17BrF2IN3OS/c1-26-15-10-5-11(21)12(18)13(20)14(10)22-16(23-15)25-8-17-3-2-4-24(17)7-9(19)6-17/h5,9H,2-4,6-8H2,1H3/t9-,17+/m1/s1 |
| InChIKey | NMHCVWLYBDHEPQ-XLFHBGCDSA-N |
| XLogP | 4.81 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.21 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|