C26H36BrF5N4O2Si — CID 170768554
7-bromo-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-N-methyl-6-(trifluoromethyl)quinazolin-4-amine (PubChem CID 170768554) has the molecular formula C26H36BrF5N4O2Si and a molecular weight of 639.58 g/mol. Its IUPAC name is 7-bromo-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-N-methyl-6-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | 7-bromo-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-N-methyl-6-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 170768554 |
| Molecular Formula | C26H36BrF5N4O2Si |
| Molecular Weight | 639.58 g/mol |
| Exact Mass | 638.17 |
| IUPAC Name | 7-bromo-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-N-methyl-6-(trifluoromethyl)quinazolin-4-amine |
| SMILES | CN(CCO[Si](C)(C)C(C)(C)C)c1nc(OC[C@@]23CCCN2C[C@H](F)C3)nc2c(F)c(Br)c(C(F)(F)F)cc12 |
| InChI | InChI=1S/C26H36BrF5N4O2Si/c1-24(2,3)39(5,6)38-11-10-35(4)22-17-12-18(26(30,31)32)19(27)20(29)21(17)33-23(34-22)37-15-25-8-7-9-36(25)14-16(28)13-25/h12,16H,7-11,13-15H2,1-6H3/t16-,25+/m1/s1 |
| InChIKey | QFBCBCZSQHQVBJ-CPJLOUKISA-N |
| XLogP | 6.96 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.58 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|