C28H38BrClFN5O2Si — CID 175989626
7-bromo-4-[[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]-methylamino]-6-chloro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazoline-8-carbonitrile (PubChem CID 175989626) has the molecular formula C28H38BrClFN5O2Si and a molecular weight of 639.09 g/mol. Its IUPAC name is 7-bromo-4-[[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]-methylamino]-6-chloro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazoline-8-carbonitrile.
| Compound Name | 7-bromo-4-[[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]-methylamino]-6-chloro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazoline-8-carbonitrile |
|---|---|
| PubChem CID | 175989626 |
| Molecular Formula | C28H38BrClFN5O2Si |
| Molecular Weight | 639.09 g/mol |
| Exact Mass | 637.17 |
| IUPAC Name | 7-bromo-4-[[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]-methylamino]-6-chloro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazoline-8-carbonitrile |
| SMILES | CN(c1nc(OC[C@@]23CCCN2C[C@H](F)C3)nc2c(C#N)c(Br)c(Cl)cc12)C1CC(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C28H38BrClFN5O2Si/c1-27(2,3)39(5,6)38-19-10-18(11-19)35(4)25-20-12-22(30)23(29)21(14-32)24(20)33-26(34-25)37-16-28-8-7-9-36(28)15-17(31)13-28/h12,17-19H,7-11,13,15-16H2,1-6H3/t17-,18?,19?,28+/m1/s1 |
| InChIKey | BMEGMORVYGSVKD-KLAFXHHKSA-N |
| XLogP | 6.86 |
| TPSA | 74.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.09 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|