C26H33BrF2IN5O3 — CID 164904040
tert-butyl (3R)-3-[[7-bromo-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6-iodoquinazolin-4-yl]-methylamino]pyrrolidine-1-carboxylate (PubChem CID 164904040) has the molecular formula C26H33BrF2IN5O3 and a molecular weight of 708.39 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[7-bromo-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6-iodoquinazolin-4-yl]-methylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[7-bromo-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6-iodoquinazolin-4-yl]-methylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 164904040 |
| Molecular Formula | C26H33BrF2IN5O3 |
| Molecular Weight | 708.39 g/mol |
| Exact Mass | 707.08 |
| IUPAC Name | tert-butyl (3R)-3-[[7-bromo-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6-iodoquinazolin-4-yl]-methylamino]pyrrolidine-1-carboxylate |
| SMILES | CN(c1nc(OC[C@@]23CCCN2C[C@H](F)C3)nc2c(F)c(Br)c(I)cc12)[C@@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C26H33BrF2IN5O3/c1-25(2,3)38-24(36)34-9-6-16(13-34)33(4)22-17-10-18(30)19(27)20(29)21(17)31-23(32-22)37-14-26-7-5-8-35(26)12-15(28)11-26/h10,15-16H,5-9,11-14H2,1-4H3/t15-,16-,26+/m1/s1 |
| InChIKey | NYUZEYWYTJJKSP-FBJHADKPSA-N |
| XLogP | 5.54 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.39 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|