C28H35BrF3N5O3 — CID 170624250
tert-butyl 3-[7-bromo-6,8-difluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-methylquinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 170624250) has the molecular formula C28H35BrF3N5O3 and a molecular weight of 626.52 g/mol. Its IUPAC name is tert-butyl 3-[7-bromo-6,8-difluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-methylquinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[7-bromo-6,8-difluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-methylquinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 170624250 |
| Molecular Formula | C28H35BrF3N5O3 |
| Molecular Weight | 626.52 g/mol |
| Exact Mass | 625.19 |
| IUPAC Name | tert-butyl 3-[7-bromo-6,8-difluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-methylquinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | Cc1c(F)c(Br)c(F)c2nc(OC[C@@]34CCCN3C[C@H](F)C4)nc(N3CC4CCC(C3)N4C(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C28H35BrF3N5O3/c1-15-19-23(22(32)20(29)21(15)31)33-25(39-14-28-8-5-9-36(28)11-16(30)10-28)34-24(19)35-12-17-6-7-18(13-35)37(17)26(38)40-27(2,3)4/h16-18H,5-14H2,1-4H3/t16-,17?,18?,28+/m1/s1 |
| InChIKey | DYZVYSUBPHATAX-WPJXVWNHSA-N |
| XLogP | 5.52 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|