C27H35ClF2N6O4 — CID 166069127
tert-butyl (1R,5S)-3-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-methoxypyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 166069127) has the molecular formula C27H35ClF2N6O4 and a molecular weight of 581.06 g/mol. Its IUPAC name is tert-butyl (1R,5S)-3-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-methoxypyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (1R,5S)-3-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-methoxypyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 166069127 |
| Molecular Formula | C27H35ClF2N6O4 |
| Molecular Weight | 581.06 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | tert-butyl (1R,5S)-3-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-methoxypyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COc1nc(Cl)c(F)c2nc(OC[C@@]34CCCN3C[C@H](F)C4)nc(N3C[C@H]4CC[C@@H](C3)N4C(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C27H35ClF2N6O4/c1-26(2,3)40-25(37)36-16-6-7-17(36)13-34(12-16)22-18-20(19(30)21(28)32-23(18)38-4)31-24(33-22)39-14-27-8-5-9-35(27)11-15(29)10-27/h15-17H,5-14H2,1-4H3/t15-,16-,17+,27+/m1/s1 |
| InChIKey | SWJRTEINTIJMJH-DJUOKHKMSA-N |
| XLogP | 4.37 |
| TPSA | 93.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.06 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|