C27H40ClFN6O4 — CID 169255750
tert-butyl 4-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5-methoxypyrido[4,3-d]pyrimidin-4-yl]piperazine-1-carboxylate;ethane (PubChem CID 169255750) has the molecular formula C27H40ClFN6O4 and a molecular weight of 567.11 g/mol. Its IUPAC name is tert-butyl 4-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5-methoxypyrido[4,3-d]pyrimidin-4-yl]piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5-methoxypyrido[4,3-d]pyrimidin-4-yl]piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 169255750 |
| Molecular Formula | C27H40ClFN6O4 |
| Molecular Weight | 567.11 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | tert-butyl 4-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5-methoxypyrido[4,3-d]pyrimidin-4-yl]piperazine-1-carboxylate;ethane |
| SMILES | CC.COc1nc(Cl)c(F)c2nc(OCC34CCCN3CCC4)nc(N3CCN(C(=O)OC(C)(C)C)CC3)c12 |
| InChI | InChI=1S/C25H34ClFN6O4.C2H6/c1-24(2,3)37-23(34)32-13-11-31(12-14-32)20-16-18(17(27)19(26)29-21(16)35-4)28-22(30-20)36-15-25-7-5-9-33(25)10-6-8-25;1-2/h5-15H2,1-4H3;1-2H3 |
| InChIKey | CNTYMBMEGJBTPK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 93.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.11 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|