C26H36ClFN6O3 — CID 176863249
tert-butyl (2S,6R)-4-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2,6-dimethylpiperazine-1-carboxylate (PubChem CID 176863249) has the molecular formula C26H36ClFN6O3 and a molecular weight of 535.06 g/mol. Its IUPAC name is tert-butyl (2S,6R)-4-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2,6-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S,6R)-4-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2,6-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 176863249 |
| Molecular Formula | C26H36ClFN6O3 |
| Molecular Weight | 535.06 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | tert-butyl (2S,6R)-4-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2,6-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2nc(OCC34CCCN3CCC4)nc3c(F)c(Cl)ncc23)C[C@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H36ClFN6O3/c1-16-13-32(14-17(2)34(16)24(35)37-25(3,4)5)22-18-12-29-21(27)19(28)20(18)30-23(31-22)36-15-26-8-6-10-33(26)11-7-9-26/h12,16-17H,6-11,13-15H2,1-5H3/t16-,17+ |
| InChIKey | ACRGMEBESZZUCR-CALCHBBNSA-N |
| XLogP | 4.66 |
| TPSA | 83.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.06 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|