C27H35ClF2N6O3 — CID 164521758
tert-butyl (1R,5S)-3-[7-chloro-8-fluoro-2-[[3-(fluoromethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 164521758) has the molecular formula C27H35ClF2N6O3 and a molecular weight of 565.07 g/mol. Its IUPAC name is tert-butyl (1R,5S)-3-[7-chloro-8-fluoro-2-[[3-(fluoromethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (1R,5S)-3-[7-chloro-8-fluoro-2-[[3-(fluoromethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 164521758 |
| Molecular Formula | C27H35ClF2N6O3 |
| Molecular Weight | 565.07 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | tert-butyl (1R,5S)-3-[7-chloro-8-fluoro-2-[[3-(fluoromethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CN(c1nc(OCC34CCCN3C(CF)CC4)nc3c(F)c(Cl)ncc13)C2 |
| InChI | InChI=1S/C27H35ClF2N6O3/c1-26(2,3)39-25(37)36-17-5-6-18(36)14-34(13-17)23-19-12-31-22(28)20(30)21(19)32-24(33-23)38-15-27-8-4-10-35(27)16(11-29)7-9-27/h12,16-18H,4-11,13-15H2,1-3H3/t16?,17-,18+,27? |
| InChIKey | IBFRDSRMMSWTQA-DUGXXBLHSA-N |
| XLogP | 4.75 |
| TPSA | 83.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.07 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|