C30H46ClFN6O3 — CID 169255162
tert-butyl N-[6-[4-amino-7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-5-yl]hexyl]-N-butylcarbamate (PubChem CID 169255162) has the molecular formula C30H46ClFN6O3 and a molecular weight of 593.19 g/mol. Its IUPAC name is tert-butyl N-[6-[4-amino-7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-5-yl]hexyl]-N-butylcarbamate.
| Compound Name | tert-butyl N-[6-[4-amino-7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-5-yl]hexyl]-N-butylcarbamate |
|---|---|
| PubChem CID | 169255162 |
| Molecular Formula | C30H46ClFN6O3 |
| Molecular Weight | 593.19 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | tert-butyl N-[6-[4-amino-7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-5-yl]hexyl]-N-butylcarbamate |
| SMILES | CCCCN(CCCCCCc1nc(Cl)c(F)c2nc(OCC34CCCN3CCC4)nc(N)c12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H46ClFN6O3/c1-5-6-16-37(28(39)41-29(2,3)4)17-10-8-7-9-13-21-22-24(23(32)25(31)34-21)35-27(36-26(22)33)40-20-30-14-11-18-38(30)19-12-15-30/h5-20H2,1-4H3,(H2,33,35,36) |
| InChIKey | DTNYVHAGDFSJFJ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.19 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|