C27H34BrClFN5O3 — CID 166460613
tert-butyl 8-[7-bromo-6-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 166460613) has the molecular formula C27H34BrClFN5O3 and a molecular weight of 610.96 g/mol. Its IUPAC name is tert-butyl 8-[7-bromo-6-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | tert-butyl 8-[7-bromo-6-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 166460613 |
| Molecular Formula | C27H34BrClFN5O3 |
| Molecular Weight | 610.96 g/mol |
| Exact Mass | 609.15 |
| IUPAC Name | tert-butyl 8-[7-bromo-6-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC(C1)N2c1nc(OCC23CCCN2CCC3)nc2c(F)c(Br)c(Cl)cc12 |
| InChI | InChI=1S/C27H34BrClFN5O3/c1-26(2,3)38-25(36)33-13-16-6-7-17(14-33)35(16)23-18-12-19(29)20(28)21(30)22(18)31-24(32-23)37-15-27-8-4-10-34(27)11-5-9-27/h12,16-17H,4-11,13-15H2,1-3H3 |
| InChIKey | NBCPAGULKVQOHD-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.96 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|