C28H34BrClFN5O3 — CID 166095880
tert-butyl (1R,5S)-3-[7-bromo-6-chloro-8-fluoro-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 166095880) has the molecular formula C28H34BrClFN5O3 and a molecular weight of 622.97 g/mol. Its IUPAC name is tert-butyl (1R,5S)-3-[7-bromo-6-chloro-8-fluoro-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (1R,5S)-3-[7-bromo-6-chloro-8-fluoro-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 166095880 |
| Molecular Formula | C28H34BrClFN5O3 |
| Molecular Weight | 622.97 g/mol |
| Exact Mass | 621.15 |
| IUPAC Name | tert-butyl (1R,5S)-3-[7-bromo-6-chloro-8-fluoro-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | C=C1CN2CCCC2(COc2nc(N3C[C@H]4CC[C@@H](C3)N4C(=O)OC(C)(C)C)c3cc(Cl)c(Br)c(F)c3n2)C1 |
| InChI | InChI=1S/C28H34BrClFN5O3/c1-16-11-28(8-5-9-35(28)12-16)15-38-25-32-23-19(10-20(30)21(29)22(23)31)24(33-25)34-13-17-6-7-18(14-34)36(17)26(37)39-27(2,3)4/h10,17-18H,1,5-9,11-15H2,2-4H3/t17-,18+,28? |
| InChIKey | RRDCDZOJKKNJFO-GLLFSFACSA-N |
| XLogP | 5.95 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.97 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|