C27H32BrF4N5O3 — CID 170624042
tert-butyl 3-[7-bromo-5,6,8-trifluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 170624042) has the molecular formula C27H32BrF4N5O3 and a molecular weight of 630.48 g/mol. Its IUPAC name is tert-butyl 3-[7-bromo-5,6,8-trifluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[7-bromo-5,6,8-trifluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 170624042 |
| Molecular Formula | C27H32BrF4N5O3 |
| Molecular Weight | 630.48 g/mol |
| Exact Mass | 629.16 |
| IUPAC Name | tert-butyl 3-[7-bromo-5,6,8-trifluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CN(c1nc(OC[C@@]34CCCN3C[C@H](F)C4)nc3c(F)c(Br)c(F)c(F)c13)C2 |
| InChI | InChI=1S/C27H32BrF4N5O3/c1-26(2,3)40-25(38)37-15-5-6-16(37)12-35(11-15)23-17-19(30)20(31)18(28)21(32)22(17)33-24(34-23)39-13-27-7-4-8-36(27)10-14(29)9-27/h14-16H,4-13H2,1-3H3/t14-,15?,16?,27+/m1/s1 |
| InChIKey | KGCHCKFTNFSAMR-CEQPARISSA-N |
| XLogP | 5.35 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|