C27H33BrClF2N5O3 — CID 168995385
tert-butyl 1-[7-bromo-6-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate (PubChem CID 168995385) has the molecular formula C27H33BrClF2N5O3 and a molecular weight of 628.95 g/mol. Its IUPAC name is tert-butyl 1-[7-bromo-6-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl 1-[7-bromo-6-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 168995385 |
| Molecular Formula | C27H33BrClF2N5O3 |
| Molecular Weight | 628.95 g/mol |
| Exact Mass | 627.14 |
| IUPAC Name | tert-butyl 1-[7-bromo-6-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2C1CCN2c1nc(OC[C@@]23CCCN2C[C@H](F)C3)nc2c(F)c(Br)c(Cl)cc12 |
| InChI | InChI=1S/C27H33BrClF2N5O3/c1-26(2,3)39-25(37)36-10-6-18-19(36)5-9-35(18)23-16-11-17(29)20(28)21(31)22(16)32-24(33-23)38-14-27-7-4-8-34(27)13-15(30)12-27/h11,15,18-19H,4-10,12-14H2,1-3H3/t15-,18?,19?,27+/m1/s1 |
| InChIKey | VXFWLSWKWYJBEB-HNOGSUDMSA-N |
| XLogP | 5.73 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.95 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|