C25H33BrF3N5O2 — CID 170623937
7-bromo-N-[[1-(dimethylamino)cyclobutyl]methyl]-6,8-difluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-methoxy-N-methylquinazolin-4-amine (PubChem CID 170623937) has the molecular formula C25H33BrF3N5O2 and a molecular weight of 572.47 g/mol. Its IUPAC name is 7-bromo-N-[[1-(dimethylamino)cyclobutyl]methyl]-6,8-difluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-methoxy-N-methylquinazolin-4-amine.
| Compound Name | 7-bromo-N-[[1-(dimethylamino)cyclobutyl]methyl]-6,8-difluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-methoxy-N-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 170623937 |
| Molecular Formula | C25H33BrF3N5O2 |
| Molecular Weight | 572.47 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 7-bromo-N-[[1-(dimethylamino)cyclobutyl]methyl]-6,8-difluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5-methoxy-N-methylquinazolin-4-amine |
| SMILES | COc1c(F)c(Br)c(F)c2nc(OC[C@@]34CCCN3C[C@H](F)C4)nc(N(C)CC3(N(C)C)CCC3)c12 |
| InChI | InChI=1S/C25H33BrF3N5O2/c1-32(2)24(7-5-8-24)13-33(3)22-16-20(18(28)17(26)19(29)21(16)35-4)30-23(31-22)36-14-25-9-6-10-34(25)12-15(27)11-25/h15H,5-14H2,1-4H3/t15-,25+/m1/s1 |
| InChIKey | VZYCZYANISOBKK-BZQUYTCOSA-N |
| XLogP | 4.55 |
| TPSA | 53.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|