C23H27BrF2N4O2 — CID 169126379
(3R)-1-[7-bromo-6,8-difluoro-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]quinazolin-4-yl]-3-methylpiperidin-3-ol (PubChem CID 169126379) has the molecular formula C23H27BrF2N4O2 and a molecular weight of 509.40 g/mol. Its IUPAC name is (3R)-1-[7-bromo-6,8-difluoro-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]quinazolin-4-yl]-3-methylpiperidin-3-ol.
| Compound Name | (3R)-1-[7-bromo-6,8-difluoro-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]quinazolin-4-yl]-3-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 169126379 |
| Molecular Formula | C23H27BrF2N4O2 |
| Molecular Weight | 509.40 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | (3R)-1-[7-bromo-6,8-difluoro-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]quinazolin-4-yl]-3-methylpiperidin-3-ol |
| SMILES | C=C1CN2CCCC2(COc2nc(N3CCC[C@@](C)(O)C3)c3cc(F)c(Br)c(F)c3n2)C1 |
| InChI | InChI=1S/C23H27BrF2N4O2/c1-14-10-23(6-4-8-30(23)11-14)13-32-21-27-19-15(9-16(25)17(24)18(19)26)20(28-21)29-7-3-5-22(2,31)12-29/h9,31H,1,3-8,10-13H2,2H3/t22-,23?/m1/s1 |
| InChIKey | IEJNPTYXGKRMLG-WTQRLHSKSA-N |
| XLogP | 4.20 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|