C22H26ClFN6O — CID 174214166
7-chloro-4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidine (PubChem CID 174214166) has the molecular formula C22H26ClFN6O and a molecular weight of 444.94 g/mol. Its IUPAC name is 7-chloro-4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidine.
| Compound Name | 7-chloro-4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 174214166 |
| Molecular Formula | C22H26ClFN6O |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 7-chloro-4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidine |
| SMILES | C=C1CN2CCCC2(COc2nc(N3C[C@H]4CC[C@@H](C3)N4)c3cnc(Cl)c(F)c3n2)C1 |
| InChI | InChI=1S/C22H26ClFN6O/c1-13-7-22(5-2-6-30(22)9-13)12-31-21-27-18-16(8-25-19(23)17(18)24)20(28-21)29-10-14-3-4-15(11-29)26-14/h8,14-15,26H,1-7,9-12H2/t14-,15+,22? |
| InChIKey | VLVKRYSGDDNRLL-SZLXDWMPSA-N |
| XLogP | 2.93 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|