C23H30ClFN6O — CID 170956434
7-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[(1-methyl-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyridin-4a-yl)methoxy]pyrido[4,3-d]pyrimidine (PubChem CID 170956434) has the molecular formula C23H30ClFN6O and a molecular weight of 460.99 g/mol. Its IUPAC name is 7-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[(1-methyl-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyridin-4a-yl)methoxy]pyrido[4,3-d]pyrimidine.
| Compound Name | 7-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[(1-methyl-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyridin-4a-yl)methoxy]pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 170956434 |
| Molecular Formula | C23H30ClFN6O |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 7-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[(1-methyl-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyridin-4a-yl)methoxy]pyrido[4,3-d]pyrimidine |
| SMILES | CN1CCCC2(COc3nc(N4CC5CCC(C4)N5)c4cnc(Cl)c(F)c4n3)CCCC12 |
| InChI | InChI=1S/C23H30ClFN6O/c1-30-9-3-8-23(7-2-4-17(23)30)13-32-22-28-19-16(10-26-20(24)18(19)25)21(29-22)31-11-14-5-6-15(12-31)27-14/h10,14-15,17,27H,2-9,11-13H2,1H3 |
| InChIKey | PRCZIOLMZIXUQN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|