C29H31ClF5N5O2 — CID 169153722
(3R)-1-[7-[5-amino-3-chloro-2-(trifluoromethyl)phenyl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-3-methylpiperidin-3-ol (PubChem CID 169153722) has the molecular formula C29H31ClF5N5O2 and a molecular weight of 612.04 g/mol. Its IUPAC name is (3R)-1-[7-[5-amino-3-chloro-2-(trifluoromethyl)phenyl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-3-methylpiperidin-3-ol.
| Compound Name | (3R)-1-[7-[5-amino-3-chloro-2-(trifluoromethyl)phenyl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-3-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 169153722 |
| Molecular Formula | C29H31ClF5N5O2 |
| Molecular Weight | 612.04 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | (3R)-1-[7-[5-amino-3-chloro-2-(trifluoromethyl)phenyl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-3-methylpiperidin-3-ol |
| SMILES | C[C@@]1(O)CCCN(c2nc(OC[C@@]34CCCN3C[C@H](F)C4)nc3c(F)c(-c4cc(N)cc(Cl)c4C(F)(F)F)ccc23)C1 |
| InChI | InChI=1S/C29H31ClF5N5O2/c1-27(41)6-2-8-39(14-27)25-19-5-4-18(20-10-17(36)11-21(30)22(20)29(33,34)35)23(32)24(19)37-26(38-25)42-15-28-7-3-9-40(28)13-16(31)12-28/h4-5,10-11,16,41H,2-3,6-9,12-15,36H2,1H3/t16-,27-,28+/m1/s1 |
| InChIKey | VTYVPNGAMFMPAI-JOLLRLPSSA-N |
| XLogP | 6.00 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.04 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|