C29H25ClF5N5O2 — CID 172556427
3-chloro-5-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-phenylmethoxypyrido[4,3-d]pyrimidin-7-yl]-4-(trifluoromethyl)aniline (PubChem CID 172556427) has the molecular formula C29H25ClF5N5O2 and a molecular weight of 606.00 g/mol. Its IUPAC name is 3-chloro-5-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-phenylmethoxypyrido[4,3-d]pyrimidin-7-yl]-4-(trifluoromethyl)aniline.
| Compound Name | 3-chloro-5-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-phenylmethoxypyrido[4,3-d]pyrimidin-7-yl]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 172556427 |
| Molecular Formula | C29H25ClF5N5O2 |
| Molecular Weight | 606.00 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | 3-chloro-5-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-phenylmethoxypyrido[4,3-d]pyrimidin-7-yl]-4-(trifluoromethyl)aniline |
| SMILES | Nc1cc(Cl)c(C(F)(F)F)c(-c2ncc3c(OCc4ccccc4)nc(OC[C@@]45CCCN4C[C@H](F)C5)nc3c2F)c1 |
| InChI | InChI=1S/C29H25ClF5N5O2/c30-21-10-18(36)9-19(22(21)29(33,34)35)24-23(32)25-20(12-37-24)26(41-14-16-5-2-1-3-6-16)39-27(38-25)42-15-28-7-4-8-40(28)13-17(31)11-28/h1-3,5-6,9-10,12,17H,4,7-8,11,13-15,36H2/t17-,28+/m1/s1 |
| InChIKey | VJRCQUYVPKQPHY-UULLZXFKSA-N |
| XLogP | 6.62 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.00 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|