C27H23F5N4O2 — CID 175977921
8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-naphthalen-1-yl-4-(2,2,2-trifluoroethoxy)pyrido[4,3-d]pyrimidine (PubChem CID 175977921) has the molecular formula C27H23F5N4O2 and a molecular weight of 530.50 g/mol. Its IUPAC name is 8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-naphthalen-1-yl-4-(2,2,2-trifluoroethoxy)pyrido[4,3-d]pyrimidine.
| Compound Name | 8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-naphthalen-1-yl-4-(2,2,2-trifluoroethoxy)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 175977921 |
| Molecular Formula | C27H23F5N4O2 |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-naphthalen-1-yl-4-(2,2,2-trifluoroethoxy)pyrido[4,3-d]pyrimidine |
| SMILES | Fc1c(-c2cccc3ccccc23)ncc2c(OCC(F)(F)F)nc(OC[C@@]34CCCN3C[C@H](F)C4)nc12 |
| InChI | InChI=1S/C27H23F5N4O2/c28-17-11-26(9-4-10-36(26)13-17)14-38-25-34-23-20(24(35-25)37-15-27(30,31)32)12-33-22(21(23)29)19-8-3-6-16-5-1-2-7-18(16)19/h1-3,5-8,12,17H,4,9-11,13-15H2/t17-,26+/m1/s1 |
| InChIKey | QLUXPRNFDUSEQX-QUGAMOGWSA-N |
| XLogP | 5.88 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |