C27H22F6N4O2 — CID 171828522
7-(7,8-difluoronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-(2,2,2-trifluoroethoxy)pyrido[4,3-d]pyrimidine (PubChem CID 171828522) has the molecular formula C27H22F6N4O2 and a molecular weight of 548.49 g/mol. Its IUPAC name is 7-(7,8-difluoronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-(2,2,2-trifluoroethoxy)pyrido[4,3-d]pyrimidine.
| Compound Name | 7-(7,8-difluoronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-(2,2,2-trifluoroethoxy)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 171828522 |
| Molecular Formula | C27H22F6N4O2 |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | 7-(7,8-difluoronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-(2,2,2-trifluoroethoxy)pyrido[4,3-d]pyrimidine |
| SMILES | Fc1ccc2cccc(-c3ncc4c(OCC(F)(F)F)nc(OCC56CCCN5CCC6)nc4c3F)c2c1F |
| InChI | InChI=1S/C27H22F6N4O2/c28-18-7-6-15-4-1-5-16(19(15)20(18)29)22-21(30)23-17(12-34-22)24(38-14-27(31,32)33)36-25(35-23)39-13-26-8-2-10-37(26)11-3-9-26/h1,4-7,12H,2-3,8-11,13-14H2 |
| InChIKey | CMXJNAIRZSQEPN-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |