C34H36F2N5O — CID 164534740
CID 164534740 (PubChem CID 164534740) has the molecular formula C34H36F2N5O and a molecular weight of 568.69 g/mol.
| Compound Name | CID 164534740 |
|---|---|
| PubChem CID | 164534740 |
| Molecular Formula | C34H36F2N5O |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | — |
| SMILES | CC1([C]2C=C2)CCCN(c2nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cccc5cccc(F)c45)ncc23)C1.[H][H] |
| InChI | InChI=1S/C34H34F2N5O.H2/c1-33(23-11-12-23)13-4-16-40(20-33)31-25-19-37-29(24-9-2-7-22-8-3-10-26(35)27(22)24)28(36)30(25)38-32(39-31)42-21-34-14-5-17-41(34)18-6-15-34;/h2-3,7-12,19H,4-6,13-18,20-21H2,1H3;1H |
| InChIKey | PKMLWQQMMNGAKI-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |