C31H32F2N6O2 — CID 164534704
5-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,5-diazocan-2-one (PubChem CID 164534704) has the molecular formula C31H32F2N6O2 and a molecular weight of 558.63 g/mol. Its IUPAC name is 5-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,5-diazocan-2-one.
| Compound Name | 5-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,5-diazocan-2-one |
|---|---|
| PubChem CID | 164534704 |
| Molecular Formula | C31H32F2N6O2 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | 5-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,5-diazocan-2-one |
| SMILES | O=C1CCN(c2nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cccc5cccc(F)c45)ncc23)CCCN1 |
| InChI | InChI=1S/C31H32F2N6O2/c32-23-9-2-7-20-6-1-8-21(25(20)23)27-26(33)28-22(18-35-27)29(38-14-5-13-34-24(40)10-17-38)37-30(36-28)41-19-31-11-3-15-39(31)16-4-12-31/h1-2,6-9,18H,3-5,10-17,19H2,(H,34,40) |
| InChIKey | FTVYFPGATOJXNR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |