C32H33ClFN7O2 — CID 164535459
9-[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,3,9-triazaspiro[4.5]decan-2-one (PubChem CID 164535459) has the molecular formula C32H33ClFN7O2 and a molecular weight of 602.11 g/mol. Its IUPAC name is 9-[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,3,9-triazaspiro[4.5]decan-2-one.
| Compound Name | 9-[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,3,9-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 164535459 |
| Molecular Formula | C32H33ClFN7O2 |
| Molecular Weight | 602.11 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | 9-[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,3,9-triazaspiro[4.5]decan-2-one |
| SMILES | O=C1NCC2(CCCN(c3nc(OCC45CCCN4CCC5)nc4c(F)c(-c5cccc6cccc(Cl)c56)ncc34)C2)N1 |
| InChI | InChI=1S/C32H33ClFN7O2/c33-23-9-2-7-20-6-1-8-21(24(20)23)26-25(34)27-22(16-35-26)28(40-13-3-10-31(18-40)17-36-29(42)39-31)38-30(37-27)43-19-32-11-4-14-41(32)15-5-12-32/h1-2,6-9,16H,3-5,10-15,17-19H2,(H2,36,39,42) |
| InChIKey | DOUDJKAMYIUMGP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.11 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |