C29H30F2N6O2 — CID 164534695
3-[[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]propanamide (PubChem CID 164534695) has the molecular formula C29H30F2N6O2 and a molecular weight of 532.60 g/mol. Its IUPAC name is 3-[[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]propanamide.
| Compound Name | 3-[[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]propanamide |
|---|---|
| PubChem CID | 164534695 |
| Molecular Formula | C29H30F2N6O2 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 3-[[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]propanamide |
| SMILES | CN(CCC(N)=O)c1nc(OCC23CCCN2CCC3)nc2c(F)c(-c3cccc4cccc(F)c34)ncc12 |
| InChI | InChI=1S/C29H30F2N6O2/c1-36(15-10-22(32)38)27-20-16-33-25(19-8-2-6-18-7-3-9-21(30)23(18)19)24(31)26(20)34-28(35-27)39-17-29-11-4-13-37(29)14-5-12-29/h2-3,6-9,16H,4-5,10-15,17H2,1H3,(H2,32,38) |
| InChIKey | HQLYLWFXMVTACQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |