C32H33FI2N6O — CID 178000418
N'-[7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-N,N'-diiodo-N-propylethane-1,2-diamine (PubChem CID 178000418) has the molecular formula C32H33FI2N6O and a molecular weight of 790.46 g/mol. Its IUPAC name is N'-[7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-N,N'-diiodo-N-propylethane-1,2-diamine.
| Compound Name | N'-[7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-N,N'-diiodo-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 178000418 |
| Molecular Formula | C32H33FI2N6O |
| Molecular Weight | 790.46 g/mol |
| Exact Mass | 790.08 |
| IUPAC Name | N'-[7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-N,N'-diiodo-N-propylethane-1,2-diamine |
| SMILES | C#Cc1cccc2cccc(-c3ncc4c(N(I)CCN(I)CCC)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C32H33FI2N6O/c1-3-15-40(34)18-19-41(35)30-25-20-36-28(24-12-6-11-23-10-5-9-22(4-2)26(23)24)27(33)29(25)37-31(38-30)42-21-32-13-7-16-39(32)17-8-14-32/h2,5-6,9-12,20H,3,7-8,13-19,21H2,1H3 |
| InChIKey | MLKVKGWPVXHPNP-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 57.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.46 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|