C31H30FN7O — CID 178000250
4-[7-(8-ethynyl-2,3-didehydronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperazin-1-amine (PubChem CID 178000250) has the molecular formula C31H30FN7O and a molecular weight of 535.63 g/mol. Its IUPAC name is 4-[7-(8-ethynyl-2,3-didehydronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperazin-1-amine.
| Compound Name | 4-[7-(8-ethynyl-2,3-didehydronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperazin-1-amine |
|---|---|
| PubChem CID | 178000250 |
| Molecular Formula | C31H30FN7O |
| Molecular Weight | 535.63 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | 4-[7-(8-ethynyl-2,3-didehydronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperazin-1-amine |
| SMILES | C#Cc1cccc2cc#cc(-c3ncc4c(N5CCN(N)CC5)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C31H30FN7O/c1-2-21-7-3-8-22-9-4-10-23(25(21)22)27-26(32)28-24(19-34-27)29(37-15-17-39(33)18-16-37)36-30(35-28)40-20-31-11-5-13-38(31)14-6-12-31/h1,3,7-9,19H,5-6,11-18,20,33H2 |
| InChIKey | HZQLSFWQEIWTDY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.63 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|