C33H34F2N6O — CID 170619004
7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-N-methyl-N-piperidin-4-ylpyrido[4,3-d]pyrimidin-4-amine (PubChem CID 170619004) has the molecular formula C33H34F2N6O and a molecular weight of 568.67 g/mol. Its IUPAC name is 7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-N-methyl-N-piperidin-4-ylpyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | 7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-N-methyl-N-piperidin-4-ylpyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170619004 |
| Molecular Formula | C33H34F2N6O |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | 7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-N-methyl-N-piperidin-4-ylpyrido[4,3-d]pyrimidin-4-amine |
| SMILES | C#Cc1cccc2cccc(-c3ncc4c(N(C)C5CCNCC5)nc(OC[C@@]56CCCN5CC(F)C6)nc4c3F)c12 |
| InChI | InChI=1S/C33H34F2N6O/c1-3-21-7-4-8-22-9-5-10-25(27(21)22)29-28(35)30-26(18-37-29)31(40(2)24-11-14-36-15-12-24)39-32(38-30)42-20-33-13-6-16-41(33)19-23(34)17-33/h1,4-5,7-10,18,23-24,36H,6,11-17,19-20H2,2H3/t23?,33-/m0/s1 |
| InChIKey | GCFCWBCBTQMNRZ-PLWXKYDASA-N |
| XLogP | 5.11 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|