C30H33F2N7O3S — CID 175469840
8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[3-(sulfamoylamino)piperidin-1-yl]pyrido[4,3-d]pyrimidine (PubChem CID 175469840) has the molecular formula C30H33F2N7O3S and a molecular weight of 609.70 g/mol. Its IUPAC name is 8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[3-(sulfamoylamino)piperidin-1-yl]pyrido[4,3-d]pyrimidine.
| Compound Name | 8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[3-(sulfamoylamino)piperidin-1-yl]pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 175469840 |
| Molecular Formula | C30H33F2N7O3S |
| Molecular Weight | 609.70 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | 8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[3-(sulfamoylamino)piperidin-1-yl]pyrido[4,3-d]pyrimidine |
| SMILES | NS(=O)(=O)NC1CCCN(c2nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cccc5cccc(F)c45)ncc23)C1 |
| InChI | InChI=1S/C30H33F2N7O3S/c31-23-10-2-7-19-6-1-9-21(24(19)23)26-25(32)27-22(16-34-26)28(38-13-3-8-20(17-38)37-43(33,40)41)36-29(35-27)42-18-30-11-4-14-39(30)15-5-12-30/h1-2,6-7,9-10,16,20,37H,3-5,8,11-15,17-18H2,(H2,33,40,41) |
| InChIKey | AQKCWRYBMQEWHG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.70 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |