C33H39FN6O3S — CID 164534338
[1-[7-(8-ethylnaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-yl]methanesulfonamide (PubChem CID 164534338) has the molecular formula C33H39FN6O3S and a molecular weight of 618.78 g/mol. Its IUPAC name is [1-[7-(8-ethylnaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-yl]methanesulfonamide.
| Compound Name | [1-[7-(8-ethylnaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 164534338 |
| Molecular Formula | C33H39FN6O3S |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | [1-[7-(8-ethylnaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-yl]methanesulfonamide |
| SMILES | CCc1cccc2cccc(-c3ncc4c(N5CCCC(CS(N)(=O)=O)C5)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C33H39FN6O3S/c1-2-23-9-3-10-24-11-4-12-25(27(23)24)29-28(34)30-26(18-36-29)31(39-15-5-8-22(19-39)20-44(35,41)42)38-32(37-30)43-21-33-13-6-16-40(33)17-7-14-33/h3-4,9-12,18,22H,2,5-8,13-17,19-21H2,1H3,(H2,35,41,42) |
| InChIKey | IFTNLSMCEDQHFN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |