C33H38F2N6O2S — CID 167120087
4-[4-[3-(aminosulfanylmethyl)piperidin-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-5-ethyl-6-fluoronaphthalen-2-ol (PubChem CID 167120087) has the molecular formula C33H38F2N6O2S and a molecular weight of 620.77 g/mol. Its IUPAC name is 4-[4-[3-(aminosulfanylmethyl)piperidin-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-5-ethyl-6-fluoronaphthalen-2-ol.
| Compound Name | 4-[4-[3-(aminosulfanylmethyl)piperidin-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-5-ethyl-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 167120087 |
| Molecular Formula | C33H38F2N6O2S |
| Molecular Weight | 620.77 g/mol |
| Exact Mass | 620.27 |
| IUPAC Name | 4-[4-[3-(aminosulfanylmethyl)piperidin-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-5-ethyl-6-fluoronaphthalen-2-ol |
| SMILES | CCc1c(F)ccc2cc(O)cc(-c3ncc4c(N5CCCC(CSN)C5)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C33H38F2N6O2S/c1-2-23-26(34)8-7-21-14-22(42)15-24(27(21)23)29-28(35)30-25(16-37-29)31(40-11-3-6-20(17-40)18-44-36)39-32(38-30)43-19-33-9-4-12-41(33)13-5-10-33/h7-8,14-16,20,42H,2-6,9-13,17-19,36H2,1H3 |
| InChIKey | MQERBZUHASTVHL-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.77 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|