C37H43F2N5O2 — CID 164534952
4-[4-(azocan-1-yl)-8-fluoro-2-[[(8S)-2-prop-2-enyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5-ethyl-6-fluoronaphthalen-2-ol (PubChem CID 164534952) has the molecular formula C37H43F2N5O2 and a molecular weight of 627.78 g/mol. Its IUPAC name is 4-[4-(azocan-1-yl)-8-fluoro-2-[[(8S)-2-prop-2-enyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5-ethyl-6-fluoronaphthalen-2-ol.
| Compound Name | 4-[4-(azocan-1-yl)-8-fluoro-2-[[(8S)-2-prop-2-enyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5-ethyl-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 164534952 |
| Molecular Formula | C37H43F2N5O2 |
| Molecular Weight | 627.78 g/mol |
| Exact Mass | 627.34 |
| IUPAC Name | 4-[4-(azocan-1-yl)-8-fluoro-2-[[(8S)-2-prop-2-enyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5-ethyl-6-fluoronaphthalen-2-ol |
| SMILES | C=CCC1CN2CCC[C@@]2(COc2nc(N3CCCCCCC3)c3cnc(-c4cc(O)cc5ccc(F)c(CC)c45)c(F)c3n2)C1 |
| InChI | InChI=1S/C37H43F2N5O2/c1-3-11-24-20-37(14-10-17-44(37)22-24)23-46-36-41-34-29(35(42-36)43-15-8-6-5-7-9-16-43)21-40-33(32(34)39)28-19-26(45)18-25-12-13-30(38)27(4-2)31(25)28/h3,12-13,18-19,21,24,45H,1,4-11,14-17,20,22-23H2,2H3/t24?,37-/m0/s1 |
| InChIKey | SKEAINSCYGPPSU-UUTVQGNVSA-N |
| XLogP | 7.97 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.78 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|