C33H35F2N5O3 — CID 167120206
1-[7-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidine-3-carbaldehyde (PubChem CID 167120206) has the molecular formula C33H35F2N5O3 and a molecular weight of 587.67 g/mol. Its IUPAC name is 1-[7-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidine-3-carbaldehyde.
| Compound Name | 1-[7-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidine-3-carbaldehyde |
|---|---|
| PubChem CID | 167120206 |
| Molecular Formula | C33H35F2N5O3 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | 1-[7-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidine-3-carbaldehyde |
| SMILES | CCc1c(F)ccc2cc(O)cc(-c3ncc4c(N5CCCC(C=O)C5)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C33H35F2N5O3/c1-2-23-26(34)8-7-21-14-22(42)15-24(27(21)23)29-28(35)30-25(16-36-29)31(39-11-3-6-20(17-39)18-41)38-32(37-30)43-19-33-9-4-12-40(33)13-5-10-33/h7-8,14-16,18,20,42H,2-6,9-13,17,19H2,1H3 |
| InChIKey | INXVTKYJPMROKQ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|