C28H27F2N5OS — CID 164534687
8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-N-(thietan-3-yl)pyrido[4,3-d]pyrimidin-4-amine (PubChem CID 164534687) has the molecular formula C28H27F2N5OS and a molecular weight of 519.62 g/mol. Its IUPAC name is 8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-N-(thietan-3-yl)pyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | 8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-N-(thietan-3-yl)pyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 164534687 |
| Molecular Formula | C28H27F2N5OS |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-N-(thietan-3-yl)pyrido[4,3-d]pyrimidin-4-amine |
| SMILES | Fc1c(-c2cccc3cccc(F)c23)ncc2c(NC3CSC3)nc(OCC34CCCN3CCC4)nc12 |
| InChI | InChI=1S/C28H27F2N5OS/c29-21-8-2-6-17-5-1-7-19(22(17)21)24-23(30)25-20(13-31-24)26(32-18-14-37-15-18)34-27(33-25)36-16-28-9-3-11-35(28)12-4-10-28/h1-2,5-8,13,18H,3-4,9-12,14-16H2,(H,32,33,34) |
| InChIKey | IUQKIGUBUHCBBE-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |