C32H32F2N6O — CID 176869795
8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-N-[3-(1H-pyrrol-3-yl)propyl]pyrido[4,3-d]pyrimidin-4-amine (PubChem CID 176869795) has the molecular formula C32H32F2N6O and a molecular weight of 554.65 g/mol. Its IUPAC name is 8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-N-[3-(1H-pyrrol-3-yl)propyl]pyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | 8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-N-[3-(1H-pyrrol-3-yl)propyl]pyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 176869795 |
| Molecular Formula | C32H32F2N6O |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | 8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-N-[3-(1H-pyrrol-3-yl)propyl]pyrido[4,3-d]pyrimidin-4-amine |
| SMILES | Fc1c(-c2cccc3cccc(F)c23)ncc2c(NCCCc3cc[nH]c3)nc(OCC34CCCN3CCC4)nc12 |
| InChI | InChI=1S/C32H32F2N6O/c33-25-10-2-8-22-7-1-9-23(26(22)25)28-27(34)29-24(19-37-28)30(36-14-3-6-21-11-15-35-18-21)39-31(38-29)41-20-32-12-4-16-40(32)17-5-13-32/h1-2,7-11,15,18-19,35H,3-6,12-14,16-17,20H2,(H,36,38,39) |
| InChIKey | IWDRRQBHRNPHDI-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|